C29H20O5S3 — CID 153370334
O-(6'-methoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) (benzyldisulfanyl)methanethioate (PubChem CID 153370334) has the molecular formula C29H20O5S3 and a molecular weight of 544.68 g/mol. Its IUPAC name is O-(6'-methoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) (benzyldisulfanyl)methanethioate.
| Compound Name | O-(6'-methoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) (benzyldisulfanyl)methanethioate |
|---|---|
| PubChem CID | 153370334 |
| Molecular Formula | C29H20O5S3 |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.05 |
| IUPAC Name | O-(6'-methoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) (benzyldisulfanyl)methanethioate |
| SMILES | COc1ccc2c(c1)Oc1cc(OC(=S)SSCc3ccccc3)ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C29H20O5S3/c1-31-19-11-13-23-25(15-19)33-26-16-20(32-28(35)37-36-17-18-7-3-2-4-8-18)12-14-24(26)29(23)22-10-6-5-9-21(22)27(30)34-29/h2-16H,17H2,1H3 |
| InChIKey | YRINULPEUGLQAK-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|