C32H32O9 — CID 171749794
(3-oxo-6'-pentoxycarbonyloxyspiro[2-benzofuran-1,9'-xanthene]-3'-yl) pentyl carbonate (PubChem CID 171749794) has the molecular formula C32H32O9 and a molecular weight of 560.60 g/mol. Its IUPAC name is (3-oxo-6'-pentoxycarbonyloxyspiro[2-benzofuran-1,9'-xanthene]-3'-yl) pentyl carbonate.
| Compound Name | (3-oxo-6'-pentoxycarbonyloxyspiro[2-benzofuran-1,9'-xanthene]-3'-yl) pentyl carbonate |
|---|---|
| PubChem CID | 171749794 |
| Molecular Formula | C32H32O9 |
| Molecular Weight | 560.60 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | (3-oxo-6'-pentoxycarbonyloxyspiro[2-benzofuran-1,9'-xanthene]-3'-yl) pentyl carbonate |
| SMILES | CCCCCOC(=O)Oc1ccc2c(c1)Oc1cc(OC(=O)OCCCCC)ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C32H32O9/c1-3-5-9-17-36-30(34)38-21-13-15-25-27(19-21)40-28-20-22(39-31(35)37-18-10-6-4-2)14-16-26(28)32(25)24-12-8-7-11-23(24)29(33)41-32/h7-8,11-16,19-20H,3-6,9-10,17-18H2,1-2H3 |
| InChIKey | NQYIZYVXMQKJLY-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.60 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|