C28H26O6 — CID 130229809
(6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) octanoate (PubChem CID 130229809) has the molecular formula C28H26O6 and a molecular weight of 458.51 g/mol. Its IUPAC name is (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) octanoate.
| Compound Name | (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) octanoate |
|---|---|
| PubChem CID | 130229809 |
| Molecular Formula | C28H26O6 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) octanoate |
| SMILES | CCCCCCCC(=O)Oc1ccc2c(c1)Oc1cc(O)ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C28H26O6/c1-2-3-4-5-6-11-26(30)32-19-13-15-23-25(17-19)33-24-16-18(29)12-14-22(24)28(23)21-10-8-7-9-20(21)27(31)34-28/h7-10,12-17,29H,2-6,11H2,1H3 |
| InChIKey | IEDXWVFSBRPYTF-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|