C26H23NO5 — CID 177336949
N-(6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl)hexanamide (PubChem CID 177336949) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is N-(6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl)hexanamide.
| Compound Name | N-(6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl)hexanamide |
|---|---|
| PubChem CID | 177336949 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | N-(6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl)hexanamide |
| SMILES | CCCCCC(=O)Nc1ccc2c(c1)Oc1cc(O)ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C26H23NO5/c1-2-3-4-9-24(29)27-16-10-12-20-22(14-16)31-23-15-17(28)11-13-21(23)26(20)19-8-6-5-7-18(19)25(30)32-26/h5-8,10-15,28H,2-4,9H2,1H3,(H,27,29) |
| InChIKey | BAZAYILKLNNQIF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|