C30H26N2O7S — CID 22862103
(6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate (PubChem CID 22862103) has the molecular formula C30H26N2O7S and a molecular weight of 558.61 g/mol. Its IUPAC name is (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate.
| Compound Name | (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
|---|---|
| PubChem CID | 22862103 |
| Molecular Formula | C30H26N2O7S |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
| SMILES | O=C1N[C@H]2[C@H](CS[C@H]2CCCCC(=O)Oc2ccc3c(c2)Oc2cc(O)ccc2C32OC(=O)c3ccccc32)N1 |
| InChI | InChI=1S/C30H26N2O7S/c33-16-9-11-20-23(13-16)38-24-14-17(10-12-21(24)30(20)19-6-2-1-5-18(19)28(35)39-30)37-26(34)8-4-3-7-25-27-22(15-40-25)31-29(36)32-27/h1-2,5-6,9-14,22,25,27,33H,3-4,7-8,15H2,(H2,31,32,36)/t22-,25-,27-,30?/m0/s1 |
| InChIKey | OBKPWNVPXDFDIJ-PPEGJCQSSA-N |
| XLogP | 4.59 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|