C28H19NO9 — CID 67127068
(6'-acetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate;pyrrole-2,5-dione (PubChem CID 67127068) has the molecular formula C28H19NO9 and a molecular weight of 513.46 g/mol. Its IUPAC name is (6'-acetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate;pyrrole-2,5-dione.
| Compound Name | (6'-acetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate;pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67127068 |
| Molecular Formula | C28H19NO9 |
| Molecular Weight | 513.46 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | (6'-acetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate;pyrrole-2,5-dione |
| SMILES | CC(=O)Oc1ccc2c(c1)Oc1cc(OC(C)=O)ccc1C21OC(=O)c2ccccc21.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C24H16O7.C4H3NO2/c1-13(25)28-15-7-9-19-21(11-15)30-22-12-16(29-14(2)26)8-10-20(22)24(19)18-6-4-3-5-17(18)23(27)31-24;6-3-1-2-4(7)5-3/h3-12H,1-2H3;1-2H,(H,5,6,7) |
| InChIKey | DBDNANMHGGTFCD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|