C23H14O8 — CID 90689393
3'-acetyloxy-6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid (PubChem CID 90689393) has the molecular formula C23H14O8 and a molecular weight of 418.36 g/mol. Its IUPAC name is 3'-acetyloxy-6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid.
| Compound Name | 3'-acetyloxy-6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid |
|---|---|
| PubChem CID | 90689393 |
| Molecular Formula | C23H14O8 |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 3'-acetyloxy-6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid |
| SMILES | CC(=O)Oc1ccc2c(c1)Oc1cc(O)ccc1C21OC(=O)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C23H14O8/c1-11(24)29-14-4-7-18-20(10-14)30-19-9-13(25)3-6-17(19)23(18)16-5-2-12(21(26)27)8-15(16)22(28)31-23/h2-10,25H,1H3,(H,26,27) |
| InChIKey | SMKDDFXPLCLGAP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|