C23H17NO5 — CID 58325865
(5-amino-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate (PubChem CID 58325865) has the molecular formula C23H17NO5 and a molecular weight of 387.39 g/mol. Its IUPAC name is (5-amino-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate.
| Compound Name | (5-amino-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
|---|---|
| PubChem CID | 58325865 |
| Molecular Formula | C23H17NO5 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | (5-amino-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)Oc1cc(C)ccc1C21OC(=O)c2cc(N)ccc21 |
| InChI | InChI=1S/C23H17NO5/c1-12-3-6-18-20(9-12)28-21-11-15(27-13(2)25)5-8-19(21)23(18)17-7-4-14(24)10-16(17)22(26)29-23/h3-11H,24H2,1-2H3 |
| InChIKey | NZHLUSWBKPADBR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|