C32H19NO5 — CID 58325863
[5-[2-(4-cyanophenyl)ethynyl]-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate (PubChem CID 58325863) has the molecular formula C32H19NO5 and a molecular weight of 497.51 g/mol. Its IUPAC name is [5-[2-(4-cyanophenyl)ethynyl]-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate.
| Compound Name | [5-[2-(4-cyanophenyl)ethynyl]-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate |
|---|---|
| PubChem CID | 58325863 |
| Molecular Formula | C32H19NO5 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | [5-[2-(4-cyanophenyl)ethynyl]-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)Oc1cc(C)ccc1C21OC(=O)c2cc(C#Cc3ccc(C#N)cc3)ccc21 |
| InChI | InChI=1S/C32H19NO5/c1-19-3-12-27-29(15-19)37-30-17-24(36-20(2)34)11-14-28(30)32(27)26-13-10-22(16-25(26)31(35)38-32)7-4-21-5-8-23(18-33)9-6-21/h3,5-6,8-17H,1-2H3 |
| InChIKey | AFCHMUXEFNKKNB-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|