C29H24O9 — CID 140772643
tert-butyl 3',6'-diacetyloxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylate (PubChem CID 140772643) has the molecular formula C29H24O9 and a molecular weight of 516.50 g/mol. Its IUPAC name is tert-butyl 3',6'-diacetyloxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylate.
| Compound Name | tert-butyl 3',6'-diacetyloxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylate |
|---|---|
| PubChem CID | 140772643 |
| Molecular Formula | C29H24O9 |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | tert-butyl 3',6'-diacetyloxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylate |
| SMILES | CC(=O)Oc1ccc2c(c1)Oc1cc(OC(C)=O)ccc1C21OC(=O)c2ccc(C(=O)OC(C)(C)C)cc21 |
| InChI | InChI=1S/C29H24O9/c1-15(30)34-18-7-10-21-24(13-18)36-25-14-19(35-16(2)31)8-11-22(25)29(21)23-12-17(26(32)37-28(3,4)5)6-9-20(23)27(33)38-29/h6-14H,1-5H3 |
| InChIKey | GQMCFLDBVOYTKI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|