About 3'-acetyloxy-6'-hydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid
3'-acetyloxy-6'-hydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid (PubChem CID 54321497) has the molecular formula C23H14O8
and a molecular weight of 418.36 g/mol. Its IUPAC name is 3'-acetyloxy-6'-hydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid.
Molecular Properties
| Compound Name | 3'-acetyloxy-6'-hydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid |
| PubChem CID | 54321497 |
| Molecular Formula | C23H14O8 |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 3'-acetyloxy-6'-hydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid |
| SMILES | CC(=O)Oc1ccc2c(c1)Oc1cc(O)ccc1C21OC(=O)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C23H14O8/c1-11(24)29-14-4-7-17-20(10-14)30-19-9-13(25)3-6-16(19)23(17)18-8-12(21(26)27)2-5-15(18)22(28)31-23/h2-10,25H,1H3,(H,26,27) |
| InChIKey | SRZQNZWGWWLHPV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3'-acetyloxy-6'-hydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-acetyloxy-6'-hydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid?
The IUPAC name of 3'-acetyloxy-6'-hydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid (CID 54321497) is 3'-acetyloxy-6'-hydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid.
What is the SMILES notation for 3'-acetyloxy-6'-hydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid?
The canonical SMILES for 3'-acetyloxy-6'-hydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid is CC(=O)Oc1ccc2c(c1)Oc1cc(O)ccc1C21OC(=O)c2ccc(C(=O)O)cc21.
What is the InChIKey of 3'-acetyloxy-6'-hydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid?
The InChIKey is SRZQNZWGWWLHPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14O8/c1-11(24)29-14-4-7-17-20(10-14)30-19-9-13(25)3-6-16(19)23(17)18-8-12(21(26)27)2-5-15(18)22(28)31-23/h2-10,25H,1H3,(H,26,27).
What are the key properties of 3'-acetyloxy-6'-hydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid?
3'-acetyloxy-6'-hydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid has a molecular weight of 418.36 g/mol, XLogP of 3.58, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-acetyloxy-6'-hydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid is sourced from PubChem (CID 54321497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).