About Thymolphthalein
Thymolphthalein (PubChem CID 31316) has the molecular formula C28H30O4
and a molecular weight of 430.50 g/mol. Its IUPAC name is 3,3-bis(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-2-benzofuran-1-one.
Molecular Properties
| Compound Name | Thymolphthalein |
| PubChem CID | 31316 |
| Molecular Formula | C28H30O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 3,3-bis(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-2-benzofuran-1-one |
| SMILES | CC1=CC(=C(C=C1C2(C3=CC=CC=C3C(=O)O2)C4=CC(=C(C=C4C)O)C(C)C)C(C)C)O |
| InChI | InChI=1S/C28H30O4/c1-15(2)20-13-23(17(5)11-25(20)29)28(22-10-8-7-9-19(22)27(31)32-28)24-14-21(16(3)4)26(30)12-18(24)6/h7-16,29-30H,1-6H3 |
| InChIKey | LDKDGDIWEUUXSH-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 66.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | 636 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Thymolphthalein with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Thymolphthalein?
The IUPAC name of Thymolphthalein (CID 31316) is 3,3-bis(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-2-benzofuran-1-one.
What is the SMILES notation for Thymolphthalein?
The canonical SMILES for Thymolphthalein is CC1=CC(=C(C=C1C2(C3=CC=CC=C3C(=O)O2)C4=CC(=C(C=C4C)O)C(C)C)C(C)C)O.
What is the InChIKey of Thymolphthalein?
The InChIKey is LDKDGDIWEUUXSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H30O4/c1-15(2)20-13-23(17(5)11-25(20)29)28(22-10-8-7-9-19(22)27(31)32-28)24-14-21(16(3)4)26(30)12-18(24)6/h7-16,29-30H,1-6H3.
What are the key properties of Thymolphthalein?
Thymolphthalein has a molecular weight of 430.50 g/mol, XLogP of 6.80, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Thymolphthalein is sourced from PubChem (CID 31316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).