C33H40O5 — CID 134269242
3'-ethenyl-7'-hexoxy-2'-[(E)-2-hexoxyprop-1-enyl]spiro[2-benzofuran-3,4'-chromene]-1-one (PubChem CID 134269242) has the molecular formula C33H40O5 and a molecular weight of 516.68 g/mol. Its IUPAC name is 3'-ethenyl-7'-hexoxy-2'-[(E)-2-hexoxyprop-1-enyl]spiro[2-benzofuran-3,4'-chromene]-1-one.
| Compound Name | 3'-ethenyl-7'-hexoxy-2'-[(E)-2-hexoxyprop-1-enyl]spiro[2-benzofuran-3,4'-chromene]-1-one |
|---|---|
| PubChem CID | 134269242 |
| Molecular Formula | C33H40O5 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | 3'-ethenyl-7'-hexoxy-2'-[(E)-2-hexoxyprop-1-enyl]spiro[2-benzofuran-3,4'-chromene]-1-one |
| SMILES | C=CC1=C(/C=C(\C)OCCCCCC)Oc2cc(OCCCCCC)ccc2C12OC(=O)c1ccccc12 |
| InChI | InChI=1S/C33H40O5/c1-5-8-10-14-20-35-24(4)22-30-27(7-3)33(28-17-13-12-16-26(28)32(34)38-33)29-19-18-25(23-31(29)37-30)36-21-15-11-9-6-2/h7,12-13,16-19,22-23H,3,5-6,8-11,14-15,20-21H2,1-2,4H3/b24-22+ |
| InChIKey | PFIVNMCUTLDFPR-ZNTNEXAZSA-N |
| XLogP | 8.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|