C29H30NO4+ — CID 22957898
triethyl-(3-oxo-6'-prop-2-enoxyspiro[2-benzofuran-1,9'-xanthene]-3'-yl)azanium (PubChem CID 22957898) has the molecular formula C29H30NO4+ and a molecular weight of 456.56 g/mol. Its IUPAC name is triethyl-(3-oxo-6'-prop-2-enoxyspiro[2-benzofuran-1,9'-xanthene]-3'-yl)azanium.
| Compound Name | triethyl-(3-oxo-6'-prop-2-enoxyspiro[2-benzofuran-1,9'-xanthene]-3'-yl)azanium |
|---|---|
| PubChem CID | 22957898 |
| Molecular Formula | C29H30NO4+ |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | triethyl-(3-oxo-6'-prop-2-enoxyspiro[2-benzofuran-1,9'-xanthene]-3'-yl)azanium |
| SMILES | C=CCOc1ccc2c(c1)Oc1cc([N+](CC)(CC)CC)ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C29H30NO4/c1-5-17-32-21-14-16-25-27(19-21)33-26-18-20(30(6-2,7-3)8-4)13-15-24(26)29(25)23-12-10-9-11-22(23)28(31)34-29/h5,9-16,18-19H,1,6-8,17H2,2-4H3/q+1 |
| InChIKey | NPQBRBPNAURYHL-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|