C23H14O5 — CID 11667826
3'-hydroxy-6'-prop-2-ynoxyspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 11667826) has the molecular formula C23H14O5 and a molecular weight of 370.36 g/mol. Its IUPAC name is 3'-hydroxy-6'-prop-2-ynoxyspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 3'-hydroxy-6'-prop-2-ynoxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 11667826 |
| Molecular Formula | C23H14O5 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 3'-hydroxy-6'-prop-2-ynoxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | C#CCOc1ccc2c(c1)Oc1cc(O)ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C23H14O5/c1-2-11-26-15-8-10-19-21(13-15)27-20-12-14(24)7-9-18(20)23(19)17-6-4-3-5-16(17)22(25)28-23/h1,3-10,12-13,24H,11H2 |
| InChIKey | RAUBICRUFCFHNB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|