C27H17NO7 — CID 10389845
3'-hydroxy-6'-[(2-nitrophenyl)methoxy]spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 10389845) has the molecular formula C27H17NO7 and a molecular weight of 467.43 g/mol. Its IUPAC name is 3'-hydroxy-6'-[(2-nitrophenyl)methoxy]spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 3'-hydroxy-6'-[(2-nitrophenyl)methoxy]spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 10389845 |
| Molecular Formula | C27H17NO7 |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 3'-hydroxy-6'-[(2-nitrophenyl)methoxy]spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | O=C1OC2(c3ccc(O)cc3Oc3cc(OCc4ccccc4[N+](=O)[O-])ccc32)c2ccccc21 |
| InChI | InChI=1S/C27H17NO7/c29-17-9-11-21-24(13-17)34-25-14-18(33-15-16-5-1-4-8-23(16)28(31)32)10-12-22(25)27(21)20-7-3-2-6-19(20)26(30)35-27/h1-14,29H,15H2 |
| InChIKey | XCDQJXKDPKQUDK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|