C34H22N2O9 — CID 57134475
3',6'-bis[(2-nitrophenyl)methoxy]spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 57134475) has the molecular formula C34H22N2O9 and a molecular weight of 602.56 g/mol. Its IUPAC name is 3',6'-bis[(2-nitrophenyl)methoxy]spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-bis[(2-nitrophenyl)methoxy]spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 57134475 |
| Molecular Formula | C34H22N2O9 |
| Molecular Weight | 602.56 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | 3',6'-bis[(2-nitrophenyl)methoxy]spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | O=C1OC2(c3ccc(OCc4ccccc4[N+](=O)[O-])cc3Oc3cc(OCc4ccccc4[N+](=O)[O-])ccc32)c2ccccc21 |
| InChI | InChI=1S/C34H22N2O9/c37-33-25-9-3-4-10-26(25)34(45-33)27-15-13-23(42-19-21-7-1-5-11-29(21)35(38)39)17-31(27)44-32-18-24(14-16-28(32)34)43-20-22-8-2-6-12-30(22)36(40)41/h1-18H,19-20H2 |
| InChIKey | RSVOHKKSXFDRJJ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 140.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.56 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|