C28H18N2O11S — CID 132537982
(6'-ethoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) 2,4-dinitrobenzenesulfonate (PubChem CID 132537982) has the molecular formula C28H18N2O11S and a molecular weight of 590.52 g/mol. Its IUPAC name is (6'-ethoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) 2,4-dinitrobenzenesulfonate.
| Compound Name | (6'-ethoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) 2,4-dinitrobenzenesulfonate |
|---|---|
| PubChem CID | 132537982 |
| Molecular Formula | C28H18N2O11S |
| Molecular Weight | 590.52 g/mol |
| Exact Mass | 590.06 |
| IUPAC Name | (6'-ethoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) 2,4-dinitrobenzenesulfonate |
| SMILES | CCOc1ccc2c(c1)Oc1cc(OS(=O)(=O)c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C28H18N2O11S/c1-2-38-17-8-10-21-24(14-17)39-25-15-18(9-11-22(25)28(21)20-6-4-3-5-19(20)27(31)40-28)41-42(36,37)26-12-7-16(29(32)33)13-23(26)30(34)35/h3-15H,2H2,1H3 |
| InChIKey | RCZYMNNJAPXRDS-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 174.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|