C22H15N3O6 — CID 175118744
3'-azidooxy-6'-(methoxymethoxy)spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 175118744) has the molecular formula C22H15N3O6 and a molecular weight of 417.38 g/mol. Its IUPAC name is 3'-azidooxy-6'-(methoxymethoxy)spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 3'-azidooxy-6'-(methoxymethoxy)spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 175118744 |
| Molecular Formula | C22H15N3O6 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 3'-azidooxy-6'-(methoxymethoxy)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | COCOc1ccc2c(c1)Oc1cc(ON=[N+]=[N-])ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C22H15N3O6/c1-27-12-28-13-6-8-17-19(10-13)29-20-11-14(31-25-24-23)7-9-18(20)22(17)16-5-3-2-4-15(16)21(26)30-22/h2-11H,12H2,1H3 |
| InChIKey | XVCXFRUBBOOLEK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 111.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|