C30H21N3O9S — CID 102114339
N-[6'-[(4-acetyl-2-nitrophenyl)sulfonylamino]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]acetamide (PubChem CID 102114339) has the molecular formula C30H21N3O9S and a molecular weight of 599.58 g/mol. Its IUPAC name is N-[6'-[(4-acetyl-2-nitrophenyl)sulfonylamino]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]acetamide.
| Compound Name | N-[6'-[(4-acetyl-2-nitrophenyl)sulfonylamino]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]acetamide |
|---|---|
| PubChem CID | 102114339 |
| Molecular Formula | C30H21N3O9S |
| Molecular Weight | 599.58 g/mol |
| Exact Mass | 599.10 |
| IUPAC Name | N-[6'-[(4-acetyl-2-nitrophenyl)sulfonylamino]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(c1)Oc1cc(NS(=O)(=O)c3ccc(C(C)=O)cc3[N+](=O)[O-])ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C30H21N3O9S/c1-16(34)18-7-12-28(25(13-18)33(37)38)43(39,40)32-20-9-11-24-27(15-20)41-26-14-19(31-17(2)35)8-10-23(26)30(24)22-6-4-3-5-21(22)29(36)42-30/h3-15,32H,1-2H3,(H,31,35) |
| InChIKey | ZZFWIACNBHRYCR-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 171.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.58 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|