C22H15NO5S — CID 21279228
N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)ethanethioamide (PubChem CID 21279228) has the molecular formula C22H15NO5S and a molecular weight of 405.43 g/mol. Its IUPAC name is N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)ethanethioamide.
| Compound Name | N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)ethanethioamide |
|---|---|
| PubChem CID | 21279228 |
| Molecular Formula | C22H15NO5S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)ethanethioamide |
| SMILES | CC(=S)Nc1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C22H15NO5S/c1-11(29)23-12-2-5-16-15(8-12)21(26)28-22(16)17-6-3-13(24)9-19(17)27-20-10-14(25)4-7-18(20)22/h2-10,24-25H,1H3,(H,23,29) |
| InChIKey | DVTXHKXNSQRPCY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|