C23H17NO5S — CID 143031759
N-(3',8'-dihydroxy-3-oxospiro[2-benzofuran-1,11'-8H-cyclohepta[b]chromene]-5-yl)ethanethioamide (PubChem CID 143031759) has the molecular formula C23H17NO5S and a molecular weight of 419.46 g/mol. Its IUPAC name is N-(3',8'-dihydroxy-3-oxospiro[2-benzofuran-1,11'-8H-cyclohepta[b]chromene]-5-yl)ethanethioamide.
| Compound Name | N-(3',8'-dihydroxy-3-oxospiro[2-benzofuran-1,11'-8H-cyclohepta[b]chromene]-5-yl)ethanethioamide |
|---|---|
| PubChem CID | 143031759 |
| Molecular Formula | C23H17NO5S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | N-(3',8'-dihydroxy-3-oxospiro[2-benzofuran-1,11'-8H-cyclohepta[b]chromene]-5-yl)ethanethioamide |
| SMILES | CC(=S)Nc1ccc2c(c1)C(=O)OC21C2=C(C=CC(O)C=C2)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C23H17NO5S/c1-12(30)24-13-2-6-17-16(10-13)22(27)29-23(17)18-7-3-14(25)5-9-20(18)28-21-11-15(26)4-8-19(21)23/h2-11,14,25-26H,1H3,(H,24,30) |
| InChIKey | VXBPZIAYSJUPAC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|