C22H11Br4NO5S — CID 23183484
N-(2',4',5',7'-tetrabromo-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)ethanethioamide (PubChem CID 23183484) has the molecular formula C22H11Br4NO5S and a molecular weight of 721.01 g/mol. Its IUPAC name is N-(2',4',5',7'-tetrabromo-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)ethanethioamide.
| Compound Name | N-(2',4',5',7'-tetrabromo-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)ethanethioamide |
|---|---|
| PubChem CID | 23183484 |
| Molecular Formula | C22H11Br4NO5S |
| Molecular Weight | 721.01 g/mol |
| Exact Mass | 716.71 |
| IUPAC Name | N-(2',4',5',7'-tetrabromo-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)ethanethioamide |
| SMILES | CC(=S)Nc1ccc2c(c1)C(=O)OC21c2cc(Br)c(O)c(Br)c2Oc2c1cc(Br)c(O)c2Br |
| InChI | InChI=1S/C22H11Br4NO5S/c1-7(33)27-8-2-3-10-9(4-8)21(30)32-22(10)11-5-13(23)17(28)15(25)19(11)31-20-12(22)6-14(24)18(29)16(20)26/h2-6,28-29H,1H3,(H,27,33) |
| InChIKey | KENBNKDCUZEZSV-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.01 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|