C20H11Br2HgO6 — CID 4564401
(2',7'-dibromo-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4'-yl)mercury;hydrate (PubChem CID 4564401) has the molecular formula C20H11Br2HgO6 and a molecular weight of 707.70 g/mol. Its IUPAC name is (2',7'-dibromo-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4'-yl)mercury;hydrate.
| Compound Name | (2',7'-dibromo-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4'-yl)mercury;hydrate |
|---|---|
| PubChem CID | 4564401 |
| Molecular Formula | C20H11Br2HgO6 |
| Molecular Weight | 707.70 g/mol |
| Exact Mass | 706.86 |
| IUPAC Name | (2',7'-dibromo-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4'-yl)mercury;hydrate |
| SMILES | O.O=C1OC2(c3cc(Br)c(O)cc3Oc3c2cc(Br)c(O)c3[Hg])c2ccccc21 |
| InChI | InChI=1S/C20H9Br2O5.Hg.H2O/c21-13-5-11-17(7-15(13)23)26-18-8-16(24)14(22)6-12(18)20(11)10-4-2-1-3-9(10)19(25)27-20;;/h1-7,23-24H;;1H2 |
| InChIKey | NMUPYQYTYLMYPK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.70 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|