C26H12Br4O7 — CID 100979687
(2',4',5',7'-tetrabromo-3-oxo-6'-prop-2-enoyloxyspiro[2-benzofuran-1,9'-xanthene]-3'-yl) prop-2-enoate (PubChem CID 100979687) has the molecular formula C26H12Br4O7 and a molecular weight of 755.99 g/mol. Its IUPAC name is (2',4',5',7'-tetrabromo-3-oxo-6'-prop-2-enoyloxyspiro[2-benzofuran-1,9'-xanthene]-3'-yl) prop-2-enoate.
| Compound Name | (2',4',5',7'-tetrabromo-3-oxo-6'-prop-2-enoyloxyspiro[2-benzofuran-1,9'-xanthene]-3'-yl) prop-2-enoate |
|---|---|
| PubChem CID | 100979687 |
| Molecular Formula | C26H12Br4O7 |
| Molecular Weight | 755.99 g/mol |
| Exact Mass | 751.73 |
| IUPAC Name | (2',4',5',7'-tetrabromo-3-oxo-6'-prop-2-enoyloxyspiro[2-benzofuran-1,9'-xanthene]-3'-yl) prop-2-enoate |
| SMILES | C=CC(=O)Oc1c(Br)cc2c(c1Br)Oc1c(cc(Br)c(OC(=O)C=C)c1Br)C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C26H12Br4O7/c1-3-17(31)34-23-15(27)9-13-21(19(23)29)36-22-14(10-16(28)24(20(22)30)35-18(32)4-2)26(13)12-8-6-5-7-11(12)25(33)37-26/h3-10H,1-2H2 |
| InChIKey | BXVCMLOGNTZZRN-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.99 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|