C12H7Br3O4 — CID 22625259
(2,4,6-tribromo-3-prop-2-enoyloxyphenyl) prop-2-enoate (PubChem CID 22625259) has the molecular formula C12H7Br3O4 and a molecular weight of 454.90 g/mol. Its IUPAC name is (2,4,6-tribromo-3-prop-2-enoyloxyphenyl) prop-2-enoate.
| Compound Name | (2,4,6-tribromo-3-prop-2-enoyloxyphenyl) prop-2-enoate |
|---|---|
| PubChem CID | 22625259 |
| Molecular Formula | C12H7Br3O4 |
| Molecular Weight | 454.90 g/mol |
| Exact Mass | 451.79 |
| IUPAC Name | (2,4,6-tribromo-3-prop-2-enoyloxyphenyl) prop-2-enoate |
| SMILES | C=CC(=O)Oc1c(Br)cc(Br)c(OC(=O)C=C)c1Br |
| InChI | InChI=1S/C12H7Br3O4/c1-3-8(16)18-11-6(13)5-7(14)12(10(11)15)19-9(17)4-2/h3-5H,1-2H2 |
| InChIKey | HPNOUFWYZBRBHA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.90 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|