About [2,6-dibromo-4-[2-(3,5-dibromo-4-methylphenyl)propan-2-yl]phenyl] prop-2-enoate
[2,6-dibromo-4-[2-(3,5-dibromo-4-methylphenyl)propan-2-yl]phenyl] prop-2-enoate (PubChem CID 54180984) has the molecular formula C19H16Br4O2
and a molecular weight of 595.95 g/mol. Its IUPAC name is [2,6-dibromo-4-[2-(3,5-dibromo-4-methylphenyl)propan-2-yl]phenyl] prop-2-enoate.
Molecular Properties
| Compound Name | [2,6-dibromo-4-[2-(3,5-dibromo-4-methylphenyl)propan-2-yl]phenyl] prop-2-enoate |
| PubChem CID | 54180984 |
| Molecular Formula | C19H16Br4O2 |
| Molecular Weight | 595.95 g/mol |
| Exact Mass | 591.79 |
| IUPAC Name | [2,6-dibromo-4-[2-(3,5-dibromo-4-methylphenyl)propan-2-yl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1c(Br)cc(C(C)(C)c2cc(Br)c(C)c(Br)c2)cc1Br |
| InChI | InChI=1S/C19H16Br4O2/c1-5-17(24)25-18-15(22)8-12(9-16(18)23)19(3,4)11-6-13(20)10(2)14(21)7-11/h5-9H,1H2,2-4H3 |
| InChIKey | PBTRPSHZNBOUJA-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 595.95 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2,6-dibromo-4-[2-(3,5-dibromo-4-methylphenyl)propan-2-yl]phenyl] prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-dibromo-4-[2-(3,5-dibromo-4-methylphenyl)propan-2-yl]phenyl] prop-2-enoate?
The IUPAC name of [2,6-dibromo-4-[2-(3,5-dibromo-4-methylphenyl)propan-2-yl]phenyl] prop-2-enoate (CID 54180984) is [2,6-dibromo-4-[2-(3,5-dibromo-4-methylphenyl)propan-2-yl]phenyl] prop-2-enoate.
What is the SMILES notation for [2,6-dibromo-4-[2-(3,5-dibromo-4-methylphenyl)propan-2-yl]phenyl] prop-2-enoate?
The canonical SMILES for [2,6-dibromo-4-[2-(3,5-dibromo-4-methylphenyl)propan-2-yl]phenyl] prop-2-enoate is C=CC(=O)Oc1c(Br)cc(C(C)(C)c2cc(Br)c(C)c(Br)c2)cc1Br.
What is the InChIKey of [2,6-dibromo-4-[2-(3,5-dibromo-4-methylphenyl)propan-2-yl]phenyl] prop-2-enoate?
The InChIKey is PBTRPSHZNBOUJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16Br4O2/c1-5-17(24)25-18-15(22)8-12(9-16(18)23)19(3,4)11-6-13(20)10(2)14(21)7-11/h5-9H,1H2,2-4H3.
What are the key properties of [2,6-dibromo-4-[2-(3,5-dibromo-4-methylphenyl)propan-2-yl]phenyl] prop-2-enoate?
[2,6-dibromo-4-[2-(3,5-dibromo-4-methylphenyl)propan-2-yl]phenyl] prop-2-enoate has a molecular weight of 595.95 g/mol, XLogP of 7.46, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-dibromo-4-[2-(3,5-dibromo-4-methylphenyl)propan-2-yl]phenyl] prop-2-enoate is sourced from PubChem (CID 54180984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).