C30H24Br4O6 — CID 160720421
[2,6-dibromo-4-[2-(3,5-dibromo-4-phenoxycarbonyloxyphenyl)propan-2-yl]phenyl] phenyl carbonate;methane (PubChem CID 160720421) has the molecular formula C30H24Br4O6 and a molecular weight of 800.13 g/mol. Its IUPAC name is [2,6-dibromo-4-[2-(3,5-dibromo-4-phenoxycarbonyloxyphenyl)propan-2-yl]phenyl] phenyl carbonate;methane.
| Compound Name | [2,6-dibromo-4-[2-(3,5-dibromo-4-phenoxycarbonyloxyphenyl)propan-2-yl]phenyl] phenyl carbonate;methane |
|---|---|
| PubChem CID | 160720421 |
| Molecular Formula | C30H24Br4O6 |
| Molecular Weight | 800.13 g/mol |
| Exact Mass | 795.83 |
| IUPAC Name | [2,6-dibromo-4-[2-(3,5-dibromo-4-phenoxycarbonyloxyphenyl)propan-2-yl]phenyl] phenyl carbonate;methane |
| SMILES | C.CC(C)(c1cc(Br)c(OC(=O)Oc2ccccc2)c(Br)c1)c1cc(Br)c(OC(=O)Oc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C29H20Br4O6.CH4/c1-29(2,17-13-21(30)25(22(31)14-17)38-27(34)36-19-9-5-3-6-10-19)18-15-23(32)26(24(33)16-18)39-28(35)37-20-11-7-4-8-12-20;/h3-16H,1-2H3;1H4 |
| InChIKey | RTALOMNCLPOBND-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.13 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|