C30H30O5 — CID 170853175
diphenyl carbonate;4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-methylphenol (PubChem CID 170853175) has the molecular formula C30H30O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is diphenyl carbonate;4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-methylphenol.
| Compound Name | diphenyl carbonate;4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-methylphenol |
|---|---|
| PubChem CID | 170853175 |
| Molecular Formula | C30H30O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | diphenyl carbonate;4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-methylphenol |
| SMILES | Cc1cc(C(C)(C)c2ccc(O)c(C)c2)ccc1O.O=C(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C17H20O2.C13H10O3/c1-11-9-13(5-7-15(11)18)17(3,4)14-6-8-16(19)12(2)10-14;14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h5-10,18-19H,1-4H3;1-10H |
| InChIKey | SIUPBZJEVRSKKM-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|