C18H23O2Y- — CID 169320278
carbanide;4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-methylphenol;yttrium (PubChem CID 169320278) has the molecular formula C18H23O2Y- and a molecular weight of 360.29 g/mol. Its IUPAC name is carbanide;4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-methylphenol;yttrium.
| Compound Name | carbanide;4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-methylphenol;yttrium |
|---|---|
| PubChem CID | 169320278 |
| Molecular Formula | C18H23O2Y- |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | carbanide;4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-methylphenol;yttrium |
| SMILES | Cc1cc(C(C)(C)c2ccc(O)c(C)c2)ccc1O.[CH3-].[Y] |
| InChI | InChI=1S/C17H20O2.CH3.Y/c1-11-9-13(5-7-15(11)18)17(3,4)14-6-8-16(19)12(2)10-14;;/h5-10,18-19H,1-4H3;1H3;/q;-1; |
| InChIKey | WVGYAFYSLPJBFA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|