C31H32O3 — CID 22392546
4-[1-(4-hydroxy-3-methylphenyl)-1-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenyl]ethyl]-2-methylphenol (PubChem CID 22392546) has the molecular formula C31H32O3 and a molecular weight of 452.59 g/mol. Its IUPAC name is 4-[1-(4-hydroxy-3-methylphenyl)-1-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenyl]ethyl]-2-methylphenol.
| Compound Name | 4-[1-(4-hydroxy-3-methylphenyl)-1-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenyl]ethyl]-2-methylphenol |
|---|---|
| PubChem CID | 22392546 |
| Molecular Formula | C31H32O3 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 4-[1-(4-hydroxy-3-methylphenyl)-1-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenyl]ethyl]-2-methylphenol |
| SMILES | Cc1cc(C(C)(c2ccc(C(C)(C)c3ccc(O)cc3)cc2)c2ccc(O)c(C)c2)ccc1O |
| InChI | InChI=1S/C31H32O3/c1-20-18-25(12-16-28(20)33)31(5,26-13-17-29(34)21(2)19-26)24-8-6-22(7-9-24)30(3,4)23-10-14-27(32)15-11-23/h6-19,32-34H,1-5H3 |
| InChIKey | STMLTYYKWLXFPS-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|