C29H27FO3 — CID 90348566
4-[2-[4-[1,1-bis(4-hydroxyphenyl)ethyl]phenyl]propan-2-yl]-2-fluorophenol (PubChem CID 90348566) has the molecular formula C29H27FO3 and a molecular weight of 442.53 g/mol. Its IUPAC name is 4-[2-[4-[1,1-bis(4-hydroxyphenyl)ethyl]phenyl]propan-2-yl]-2-fluorophenol.
| Compound Name | 4-[2-[4-[1,1-bis(4-hydroxyphenyl)ethyl]phenyl]propan-2-yl]-2-fluorophenol |
|---|---|
| PubChem CID | 90348566 |
| Molecular Formula | C29H27FO3 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 4-[2-[4-[1,1-bis(4-hydroxyphenyl)ethyl]phenyl]propan-2-yl]-2-fluorophenol |
| SMILES | CC(C)(c1ccc(C(C)(c2ccc(O)cc2)c2ccc(O)cc2)cc1)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C29H27FO3/c1-28(2,23-12-17-27(33)26(30)18-23)19-4-6-20(7-5-19)29(3,21-8-13-24(31)14-9-21)22-10-15-25(32)16-11-22/h4-18,31-33H,1-3H3 |
| InChIKey | PTKYWTQHRVBSLC-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|