C29H20Br4O6 — CID 58932015
[2,6-dibromo-4-[2-(3,5-dibromo-4-phenoxycarbonyloxyphenyl)propan-2-yl]phenyl] phenyl carbonate (PubChem CID 58932015) has the molecular formula C29H20Br4O6 and a molecular weight of 784.09 g/mol. Its IUPAC name is [2,6-dibromo-4-[2-(3,5-dibromo-4-phenoxycarbonyloxyphenyl)propan-2-yl]phenyl] phenyl carbonate.
| Compound Name | [2,6-dibromo-4-[2-(3,5-dibromo-4-phenoxycarbonyloxyphenyl)propan-2-yl]phenyl] phenyl carbonate |
|---|---|
| PubChem CID | 58932015 |
| Molecular Formula | C29H20Br4O6 |
| Molecular Weight | 784.09 g/mol |
| Exact Mass | 779.80 |
| IUPAC Name | [2,6-dibromo-4-[2-(3,5-dibromo-4-phenoxycarbonyloxyphenyl)propan-2-yl]phenyl] phenyl carbonate |
| SMILES | CC(C)(c1cc(Br)c(OC(=O)Oc2ccccc2)c(Br)c1)c1cc(Br)c(OC(=O)Oc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C29H20Br4O6/c1-29(2,17-13-21(30)25(22(31)14-17)38-27(34)36-19-9-5-3-6-10-19)18-15-23(32)26(24(33)16-18)39-28(35)37-20-11-7-4-8-12-20/h3-16H,1-2H3 |
| InChIKey | LNJRAQNOSKNOOZ-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.09 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|