C33H28Br4O4 — CID 3341578
[2,6-dibromo-4-[2-[3,5-dibromo-4-(3-phenylpropanoyloxy)phenyl]propan-2-yl]phenyl] 3-phenylpropanoate (PubChem CID 3341578) has the molecular formula C33H28Br4O4 and a molecular weight of 808.20 g/mol. Its IUPAC name is [2,6-dibromo-4-[2-[3,5-dibromo-4-(3-phenylpropanoyloxy)phenyl]propan-2-yl]phenyl] 3-phenylpropanoate.
| Compound Name | [2,6-dibromo-4-[2-[3,5-dibromo-4-(3-phenylpropanoyloxy)phenyl]propan-2-yl]phenyl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 3341578 |
| Molecular Formula | C33H28Br4O4 |
| Molecular Weight | 808.20 g/mol |
| Exact Mass | 803.87 |
| IUPAC Name | [2,6-dibromo-4-[2-[3,5-dibromo-4-(3-phenylpropanoyloxy)phenyl]propan-2-yl]phenyl] 3-phenylpropanoate |
| SMILES | CC(C)(c1cc(Br)c(OC(=O)CCc2ccccc2)c(Br)c1)c1cc(Br)c(OC(=O)CCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C33H28Br4O4/c1-33(2,23-17-25(34)31(26(35)18-23)40-29(38)15-13-21-9-5-3-6-10-21)24-19-27(36)32(28(37)20-24)41-30(39)16-14-22-11-7-4-8-12-22/h3-12,17-20H,13-16H2,1-2H3 |
| InChIKey | SVTSEEWPLALSRY-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.20 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|