C31H24Br4O4 — CID 3342522
[2,6-dibromo-4-[2-[3,5-dibromo-4-(2-phenylacetyl)oxyphenyl]propan-2-yl]phenyl] 2-phenylacetate (PubChem CID 3342522) has the molecular formula C31H24Br4O4 and a molecular weight of 780.14 g/mol. Its IUPAC name is [2,6-dibromo-4-[2-[3,5-dibromo-4-(2-phenylacetyl)oxyphenyl]propan-2-yl]phenyl] 2-phenylacetate.
| Compound Name | [2,6-dibromo-4-[2-[3,5-dibromo-4-(2-phenylacetyl)oxyphenyl]propan-2-yl]phenyl] 2-phenylacetate |
|---|---|
| PubChem CID | 3342522 |
| Molecular Formula | C31H24Br4O4 |
| Molecular Weight | 780.14 g/mol |
| Exact Mass | 775.84 |
| IUPAC Name | [2,6-dibromo-4-[2-[3,5-dibromo-4-(2-phenylacetyl)oxyphenyl]propan-2-yl]phenyl] 2-phenylacetate |
| SMILES | CC(C)(c1cc(Br)c(OC(=O)Cc2ccccc2)c(Br)c1)c1cc(Br)c(OC(=O)Cc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C31H24Br4O4/c1-31(2,21-15-23(32)29(24(33)16-21)38-27(36)13-19-9-5-3-6-10-19)22-17-25(34)30(26(35)18-22)39-28(37)14-20-11-7-4-8-12-20/h3-12,15-18H,13-14H2,1-2H3 |
| InChIKey | AGFLIEXDKGFMFB-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.14 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|