C23H18Br4O3 — CID 58805686
[2,6-dibromo-4-[2-(3,5-dibromo-4-methoxyphenyl)propan-2-yl]phenyl] benzoate (PubChem CID 58805686) has the molecular formula C23H18Br4O3 and a molecular weight of 662.01 g/mol. Its IUPAC name is [2,6-dibromo-4-[2-(3,5-dibromo-4-methoxyphenyl)propan-2-yl]phenyl] benzoate.
| Compound Name | [2,6-dibromo-4-[2-(3,5-dibromo-4-methoxyphenyl)propan-2-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 58805686 |
| Molecular Formula | C23H18Br4O3 |
| Molecular Weight | 662.01 g/mol |
| Exact Mass | 657.80 |
| IUPAC Name | [2,6-dibromo-4-[2-(3,5-dibromo-4-methoxyphenyl)propan-2-yl]phenyl] benzoate |
| SMILES | COc1c(Br)cc(C(C)(C)c2cc(Br)c(OC(=O)c3ccccc3)c(Br)c2)cc1Br |
| InChI | InChI=1S/C23H18Br4O3/c1-23(2,14-9-16(24)20(29-3)17(25)10-14)15-11-18(26)21(19(27)12-15)30-22(28)13-7-5-4-6-8-13/h4-12H,1-3H3 |
| InChIKey | IMEPUQBPJLFRJK-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.01 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|