C37H22Br4N2O8 — CID 101411593
[2,6-dibromo-4-[2-[3,5-dibromo-4-[4-(2,5-dioxopyrrol-1-yl)benzoyl]oxyphenyl]propan-2-yl]phenyl] 4-(2,5-dioxopyrrol-1-yl)benzoate (PubChem CID 101411593) has the molecular formula C37H22Br4N2O8 and a molecular weight of 942.20 g/mol. Its IUPAC name is [2,6-dibromo-4-[2-[3,5-dibromo-4-[4-(2,5-dioxopyrrol-1-yl)benzoyl]oxyphenyl]propan-2-yl]phenyl] 4-(2,5-dioxopyrrol-1-yl)benzoate.
| Compound Name | [2,6-dibromo-4-[2-[3,5-dibromo-4-[4-(2,5-dioxopyrrol-1-yl)benzoyl]oxyphenyl]propan-2-yl]phenyl] 4-(2,5-dioxopyrrol-1-yl)benzoate |
|---|---|
| PubChem CID | 101411593 |
| Molecular Formula | C37H22Br4N2O8 |
| Molecular Weight | 942.20 g/mol |
| Exact Mass | 937.81 |
| IUPAC Name | [2,6-dibromo-4-[2-[3,5-dibromo-4-[4-(2,5-dioxopyrrol-1-yl)benzoyl]oxyphenyl]propan-2-yl]phenyl] 4-(2,5-dioxopyrrol-1-yl)benzoate |
| SMILES | CC(C)(c1cc(Br)c(OC(=O)c2ccc(N3C(=O)C=CC3=O)cc2)c(Br)c1)c1cc(Br)c(OC(=O)c2ccc(N3C(=O)C=CC3=O)cc2)c(Br)c1 |
| InChI | InChI=1S/C37H22Br4N2O8/c1-37(2,21-15-25(38)33(26(39)16-21)50-35(48)19-3-7-23(8-4-19)42-29(44)11-12-30(42)45)22-17-27(40)34(28(41)18-22)51-36(49)20-5-9-24(10-6-20)43-31(46)13-14-32(43)47/h3-18H,1-2H3 |
| InChIKey | HYBISYDEZLSRRM-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.20 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|