C21H28O3 — CID 91381776
(4-tert-butyl-2,6-dimethylphenyl) phenyl carbonate;ethane (PubChem CID 91381776) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (4-tert-butyl-2,6-dimethylphenyl) phenyl carbonate;ethane.
| Compound Name | (4-tert-butyl-2,6-dimethylphenyl) phenyl carbonate;ethane |
|---|---|
| PubChem CID | 91381776 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (4-tert-butyl-2,6-dimethylphenyl) phenyl carbonate;ethane |
| SMILES | CC.Cc1cc(C(C)(C)C)cc(C)c1OC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C19H22O3.C2H6/c1-13-11-15(19(3,4)5)12-14(2)17(13)22-18(20)21-16-9-7-6-8-10-16;1-2/h6-12H,1-5H3;1-2H3 |
| InChIKey | BSXSERKUOMBYHT-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|