C13H14Br2O2 — CID 23590316
(2,6-dibromo-4-butan-2-ylphenyl) prop-2-enoate (PubChem CID 23590316) has the molecular formula C13H14Br2O2 and a molecular weight of 362.06 g/mol. Its IUPAC name is (2,6-dibromo-4-butan-2-ylphenyl) prop-2-enoate.
| Compound Name | (2,6-dibromo-4-butan-2-ylphenyl) prop-2-enoate |
|---|---|
| PubChem CID | 23590316 |
| Molecular Formula | C13H14Br2O2 |
| Molecular Weight | 362.06 g/mol |
| Exact Mass | 359.94 |
| IUPAC Name | (2,6-dibromo-4-butan-2-ylphenyl) prop-2-enoate |
| SMILES | C=CC(=O)Oc1c(Br)cc(C(C)CC)cc1Br |
| InChI | InChI=1S/C13H14Br2O2/c1-4-8(3)9-6-10(14)13(11(15)7-9)17-12(16)5-2/h5-8H,2,4H2,1,3H3 |
| InChIKey | WDYYUAUZTHKWIB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.06 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|