C15H9Br3O6 — CID 18714384
[2,4,5-tribromo-3,6-di(prop-2-enoyloxy)phenyl] prop-2-enoate (PubChem CID 18714384) has the molecular formula C15H9Br3O6 and a molecular weight of 524.94 g/mol. Its IUPAC name is [2,4,5-tribromo-3,6-di(prop-2-enoyloxy)phenyl] prop-2-enoate.
| Compound Name | [2,4,5-tribromo-3,6-di(prop-2-enoyloxy)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 18714384 |
| Molecular Formula | C15H9Br3O6 |
| Molecular Weight | 524.94 g/mol |
| Exact Mass | 521.79 |
| IUPAC Name | [2,4,5-tribromo-3,6-di(prop-2-enoyloxy)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1c(Br)c(Br)c(OC(=O)C=C)c(OC(=O)C=C)c1Br |
| InChI | InChI=1S/C15H9Br3O6/c1-4-7(19)22-13-10(16)11(17)14(23-8(20)5-2)15(12(13)18)24-9(21)6-3/h4-6H,1-3H2 |
| InChIKey | QBMYBKGCWVRRGV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.94 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|