C22H15FO8 — CID 118013890
[4-fluoro-3,6,7-tri(prop-2-enoyloxy)naphthalen-2-yl] prop-2-enoate (PubChem CID 118013890) has the molecular formula C22H15FO8 and a molecular weight of 426.35 g/mol. Its IUPAC name is [4-fluoro-3,6,7-tri(prop-2-enoyloxy)naphthalen-2-yl] prop-2-enoate.
| Compound Name | [4-fluoro-3,6,7-tri(prop-2-enoyloxy)naphthalen-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 118013890 |
| Molecular Formula | C22H15FO8 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | [4-fluoro-3,6,7-tri(prop-2-enoyloxy)naphthalen-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1cc2cc(OC(=O)C=C)c(OC(=O)C=C)c(F)c2cc1OC(=O)C=C |
| InChI | InChI=1S/C22H15FO8/c1-5-17(24)28-14-9-12-10-16(30-19(26)7-3)22(31-20(27)8-4)21(23)13(12)11-15(14)29-18(25)6-2/h5-11H,1-4H2 |
| InChIKey | MYUGLOAZUZVOCM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|