C14H12O8 — CID 150180405
4,5-dimethyl-6-prop-2-enoyloxybenzene-1,2,3-tricarboxylic acid (PubChem CID 150180405) has the molecular formula C14H12O8 and a molecular weight of 308.24 g/mol. Its IUPAC name is 4,5-dimethyl-6-prop-2-enoyloxybenzene-1,2,3-tricarboxylic acid.
| Compound Name | 4,5-dimethyl-6-prop-2-enoyloxybenzene-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 150180405 |
| Molecular Formula | C14H12O8 |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 4,5-dimethyl-6-prop-2-enoyloxybenzene-1,2,3-tricarboxylic acid |
| SMILES | C=CC(=O)Oc1c(C)c(C)c(C(=O)O)c(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C14H12O8/c1-4-7(15)22-11-6(3)5(2)8(12(16)17)9(13(18)19)10(11)14(20)21/h4H,1H2,2-3H3,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | FLHMTDSKTLWACQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|