C23H24O4 — CID 141237345
[3-[(2,4-dimethyl-3-prop-2-enoyloxyphenyl)methyl]-2,6-dimethylphenyl] prop-2-enoate (PubChem CID 141237345) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is [3-[(2,4-dimethyl-3-prop-2-enoyloxyphenyl)methyl]-2,6-dimethylphenyl] prop-2-enoate.
| Compound Name | [3-[(2,4-dimethyl-3-prop-2-enoyloxyphenyl)methyl]-2,6-dimethylphenyl] prop-2-enoate |
|---|---|
| PubChem CID | 141237345 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | [3-[(2,4-dimethyl-3-prop-2-enoyloxyphenyl)methyl]-2,6-dimethylphenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1c(C)ccc(Cc2ccc(C)c(OC(=O)C=C)c2C)c1C |
| InChI | InChI=1S/C23H24O4/c1-7-20(24)26-22-14(3)9-11-18(16(22)5)13-19-12-10-15(4)23(17(19)6)27-21(25)8-2/h7-12H,1-2,13H2,3-6H3 |
| InChIKey | MZMGTBSOAFKEOF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|