C18H18N2O2 — CID 90778654
[2,6-dimethyl-4-[(4-methylphenyl)diazenyl]phenyl] prop-2-enoate (PubChem CID 90778654) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is [2,6-dimethyl-4-[(4-methylphenyl)diazenyl]phenyl] prop-2-enoate.
| Compound Name | [2,6-dimethyl-4-[(4-methylphenyl)diazenyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 90778654 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | [2,6-dimethyl-4-[(4-methylphenyl)diazenyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1c(C)cc(/N=N/c2ccc(C)cc2)cc1C |
| InChI | InChI=1S/C18H18N2O2/c1-5-17(21)22-18-13(3)10-16(11-14(18)4)20-19-15-8-6-12(2)7-9-15/h5-11H,1H2,2-4H3/b20-19+ |
| InChIKey | GYORVDKOVGFIPS-FMQUCBEESA-N |
| XLogP | 5.12 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|