C26H26O3 — CID 118402998
[4-[(4-hydroxy-3,5-dimethylphenyl)-phenylmethyl]-2,6-dimethylphenyl] prop-2-enoate (PubChem CID 118402998) has the molecular formula C26H26O3 and a molecular weight of 386.49 g/mol. Its IUPAC name is [4-[(4-hydroxy-3,5-dimethylphenyl)-phenylmethyl]-2,6-dimethylphenyl] prop-2-enoate.
| Compound Name | [4-[(4-hydroxy-3,5-dimethylphenyl)-phenylmethyl]-2,6-dimethylphenyl] prop-2-enoate |
|---|---|
| PubChem CID | 118402998 |
| Molecular Formula | C26H26O3 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | [4-[(4-hydroxy-3,5-dimethylphenyl)-phenylmethyl]-2,6-dimethylphenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1c(C)cc(C(c2ccccc2)c2cc(C)c(O)c(C)c2)cc1C |
| InChI | InChI=1S/C26H26O3/c1-6-23(27)29-26-18(4)14-22(15-19(26)5)24(20-10-8-7-9-11-20)21-12-16(2)25(28)17(3)13-21/h6-15,24,28H,1H2,2-5H3 |
| InChIKey | ZBWTYENKCHGCBP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|