C32H30O6 — CID 102112166
[4-[bis(2,5-dimethyl-4-prop-2-enoyloxyphenyl)methyl]phenyl] prop-2-enoate (PubChem CID 102112166) has the molecular formula C32H30O6 and a molecular weight of 510.59 g/mol. Its IUPAC name is [4-[bis(2,5-dimethyl-4-prop-2-enoyloxyphenyl)methyl]phenyl] prop-2-enoate.
| Compound Name | [4-[bis(2,5-dimethyl-4-prop-2-enoyloxyphenyl)methyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 102112166 |
| Molecular Formula | C32H30O6 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | [4-[bis(2,5-dimethyl-4-prop-2-enoyloxyphenyl)methyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(C(c2cc(C)c(OC(=O)C=C)cc2C)c2cc(C)c(OC(=O)C=C)cc2C)cc1 |
| InChI | InChI=1S/C32H30O6/c1-8-29(33)36-24-13-11-23(12-14-24)32(25-15-21(6)27(17-19(25)4)37-30(34)9-2)26-16-22(7)28(18-20(26)5)38-31(35)10-3/h8-18,32H,1-3H2,4-7H3 |
| InChIKey | MCPCINFALLGVLB-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|