C48H50O4 — CID 21365402
1-[[4-[bis(4-ethenoxy-2,5-dimethylphenyl)methyl]phenyl]-(4-ethenoxy-2,5-dimethylphenyl)methyl]-4-ethenoxy-2,5-dimethylbenzene (PubChem CID 21365402) has the molecular formula C48H50O4 and a molecular weight of 690.92 g/mol. Its IUPAC name is 1-[[4-[bis(4-ethenoxy-2,5-dimethylphenyl)methyl]phenyl]-(4-ethenoxy-2,5-dimethylphenyl)methyl]-4-ethenoxy-2,5-dimethylbenzene.
| Compound Name | 1-[[4-[bis(4-ethenoxy-2,5-dimethylphenyl)methyl]phenyl]-(4-ethenoxy-2,5-dimethylphenyl)methyl]-4-ethenoxy-2,5-dimethylbenzene |
|---|---|
| PubChem CID | 21365402 |
| Molecular Formula | C48H50O4 |
| Molecular Weight | 690.92 g/mol |
| Exact Mass | 690.37 |
| IUPAC Name | 1-[[4-[bis(4-ethenoxy-2,5-dimethylphenyl)methyl]phenyl]-(4-ethenoxy-2,5-dimethylphenyl)methyl]-4-ethenoxy-2,5-dimethylbenzene |
| SMILES | C=COc1cc(C)c(C(c2ccc(C(c3cc(C)c(OC=C)cc3C)c3cc(C)c(OC=C)cc3C)cc2)c2cc(C)c(OC=C)cc2C)cc1C |
| InChI | InChI=1S/C48H50O4/c1-13-49-43-25-29(5)39(21-33(43)9)47(40-22-34(10)44(50-14-2)26-30(40)6)37-17-19-38(20-18-37)48(41-23-35(11)45(51-15-3)27-31(41)7)42-24-36(12)46(52-16-4)28-32(42)8/h13-28,47-48H,1-4H2,5-12H3 |
| InChIKey | UBFFWBNZZHIIAC-UHFFFAOYSA-N |
| XLogP | 12.60 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.92 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|