C12H18O3 — CID 20549048
1-(dimethoxymethyl)-4-methoxy-2,5-dimethylbenzene (PubChem CID 20549048) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 1-(dimethoxymethyl)-4-methoxy-2,5-dimethylbenzene.
| Compound Name | 1-(dimethoxymethyl)-4-methoxy-2,5-dimethylbenzene |
|---|---|
| PubChem CID | 20549048 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 1-(dimethoxymethyl)-4-methoxy-2,5-dimethylbenzene |
| SMILES | COc1cc(C)c(C(OC)OC)cc1C |
| InChI | InChI=1S/C12H18O3/c1-8-7-11(13-3)9(2)6-10(8)12(14-4)15-5/h6-7,12H,1-5H3 |
| InChIKey | OANGSVWHDZVGPM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|