C13H22N2O — CID 116909230
1-(4-methoxy-2,5-dimethylphenyl)-N,N',N'-trimethylmethanediamine (PubChem CID 116909230) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-(4-methoxy-2,5-dimethylphenyl)-N,N',N'-trimethylmethanediamine.
| Compound Name | 1-(4-methoxy-2,5-dimethylphenyl)-N,N',N'-trimethylmethanediamine |
|---|---|
| PubChem CID | 116909230 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-(4-methoxy-2,5-dimethylphenyl)-N,N',N'-trimethylmethanediamine |
| SMILES | CNC(c1cc(C)c(OC)cc1C)N(C)C |
| InChI | InChI=1S/C13H22N2O/c1-9-8-12(16-6)10(2)7-11(9)13(14-3)15(4)5/h7-8,13-14H,1-6H3 |
| InChIKey | HSQYIKKQBPSQNW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|