C12H19NO2S — CID 116909428
(2,5-dimethoxy-4-methylphenyl)-(dimethylamino)methanethiol (PubChem CID 116909428) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is (2,5-dimethoxy-4-methylphenyl)-(dimethylamino)methanethiol.
| Compound Name | (2,5-dimethoxy-4-methylphenyl)-(dimethylamino)methanethiol |
|---|---|
| PubChem CID | 116909428 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (2,5-dimethoxy-4-methylphenyl)-(dimethylamino)methanethiol |
| SMILES | COc1cc(C(S)N(C)C)c(OC)cc1C |
| InChI | InChI=1S/C12H19NO2S/c1-8-6-11(15-5)9(7-10(8)14-4)12(16)13(2)3/h6-7,12,16H,1-5H3 |
| InChIKey | IDNWDAPJCCTJAV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 21.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|